CAS 82894-98-2 appears in our catalog under these names: 4-(4-Nitrophenyl)-1,2,3-thiadiazole, 98%, 4-(4-Nitrophenyl)-1,2,3-thiadiazole, 97%, 97%, 4-(4-Nitrophenyl)-1,2,3-thiadiazole. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
4-(4-nitrophenyl)thiadiazole (CAS 82894-98-2) is a chemical compound with the molecular formula C8H5N3O2S and a molecular weight of 207.21 g/mol. IUPAC name: 4-(4-nitrophenyl)thiadiazole. InChIKey: VLRKUBATYOJPSP-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O2S |
|---|---|
| Molecular weight | 207.21 g/mol |
| IUPAC name | 4-(4-nitrophenyl)thiadiazole |
| InChIKey | VLRKUBATYOJPSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSN=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)