CAS 101495-59-4 is the registry number for 2,3-Dichloro-Indole. Offered by: TRC. Available pack sizes: 5g.
2,3-dichloro-1H-indole (CAS 101495-59-4) is a chemical compound with the molecular formula C8H5Cl2N and a molecular weight of 186.03 g/mol. IUPAC name: 2,3-dichloro-1H-indole. InChIKey: QOQGUYAEXRBZQN-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N |
|---|---|
| Molecular weight | 186.03 g/mol |
| IUPAC name | 2,3-dichloro-1H-indole |
| InChIKey | QOQGUYAEXRBZQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)Cl)Cl |
Computed by PubChem (NCBI)