Products 1015-54-9
CAS 1015-54-9 is the registry number for 2-(Methoxycarbonyl)-3,6-dimethylbenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methoxycarbonyl-3,6-dimethylbenzoic acid (CAS 1015-54-9) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 2-methoxycarbonyl-3,6-dimethylbenzoic acid. InChIKey: POJXDEQEBNIOHC-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 2-methoxycarbonyl-3,6-dimethylbenzoic acid |
| InChIKey | POJXDEQEBNIOHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)