CAS 101515-46-2 is the registry number for (R)-3-((tert-Butyldimethylsilyl)oxy)butanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(3R)-3-[tert-butyl(dimethyl)silyl]oxybutanoic acid (CAS 101515-46-2) is a chemical compound with the molecular formula C10H22O3Si and a molecular weight of 218.36 g/mol. IUPAC name: (3R)-3-[tert-butyl(dimethyl)silyl]oxybutanoic acid. InChIKey: SVHGAHUUGQJELP-MRVPVSSYSA-N.
| Molecular formula | C10H22O3Si |
|---|---|
| Molecular weight | 218.36 g/mol |
| IUPAC name | (3R)-3-[tert-butyl(dimethyl)silyl]oxybutanoic acid |
| InChIKey | SVHGAHUUGQJELP-MRVPVSSYSA-N |
| SMILES | C[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)