Products 185453-76-3
CAS 185453-76-3 is the registry number for (2S,3S)-2-[(1-Ethoxyethoxy)methyl]-3-(trimethylsilyl)oxirane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(2S,3S)-3-(1-ethoxyethoxymethyl)oxiran-2-yl]-trimethylsilane (CAS 185453-76-3) is a chemical compound with the molecular formula C10H22O3Si and a molecular weight of 218.36 g/mol. IUPAC name: [(2S,3S)-3-(1-ethoxyethoxymethyl)oxiran-2-yl]-trimethylsilane. InChIKey: NOTVTJGMEDZONA-AGROOBSYSA-N.
| Molecular formula | C10H22O3Si |
|---|---|
| Molecular weight | 218.36 g/mol |
| IUPAC name | [(2S,3S)-3-(1-ethoxyethoxymethyl)oxiran-2-yl]-trimethylsilane |
| InChIKey | NOTVTJGMEDZONA-AGROOBSYSA-N |
| SMILES | CCOC(C)OC[C@H]1[C@@H](O1)[Si](C)(C)C |
Computed by PubChem (NCBI)