CAS 1793114-01-8 is the registry number for (3R,4R)-4-((tert-Butyldimethylsilyl)oxy)tetrahydrofuran-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-3-ol (CAS 1793114-01-8) is a chemical compound with the molecular formula C10H22O3Si and a molecular weight of 218.36 g/mol. IUPAC name: (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-3-ol. InChIKey: YSNOZTORLKKZMT-RKDXNWHRSA-N.
| Molecular formula | C10H22O3Si |
|---|---|
| Molecular weight | 218.36 g/mol |
| IUPAC name | (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyoxolan-3-ol |
| InChIKey | YSNOZTORLKKZMT-RKDXNWHRSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1COC[C@H]1O |
Computed by PubChem (NCBI)