CAS 774234-73-0 is the registry number for (3S)-3-((tert-Butyldimethylsilyl)oxy)tetrahydrofuran-2-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(3S)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-ol (CAS 774234-73-0) is a chemical compound with the molecular formula C10H22O3Si and a molecular weight of 218.36 g/mol. IUPAC name: (3S)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-ol. InChIKey: FTGBNEVOLLUEEN-IENPIDJESA-N.
| Molecular formula | C10H22O3Si |
|---|---|
| Molecular weight | 218.36 g/mol |
| IUPAC name | (3S)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-ol |
| InChIKey | FTGBNEVOLLUEEN-IENPIDJESA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCOC1O |
Computed by PubChem (NCBI)