Products 69171-62-6

CAS 69171-62-6 is the registry number for 4-((tert-Butyldimethylsilyl)oxy)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 2g, 1g.

Structural formula: {0} (CAS {1})

4-[tert-butyl(dimethyl)silyl]oxybutanoic acid (CAS 69171-62-6) is a chemical compound with the molecular formula C10H22O3Si and a molecular weight of 218.36 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxybutanoic acid. InChIKey: SSKZSPIXTLWDEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H22O3Si
Molecular weight218.36 g/mol
IUPAC name4-[tert-butyl(dimethyl)silyl]oxybutanoic acid
InChIKeySSKZSPIXTLWDEZ-UHFFFAOYSA-N
SMILESCC(C)(C)[Si](C)(C)OCCCC(=O)O

Computed by PubChem (NCBI)