CAS 1015248-96-0 appears in our catalog under these names: (S)-2-Phenyl-3,4-dihydro-2h-benzo[4,5]thiazolo[3,2-a]pyrimidine 98%, (S)-2-Phenyl-3,4-dihydro-2h-benzo[4,5]thiazolo[3,2-a]pyrimidine, 98%, 98%, (2S)-2-Phenyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazole, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(2S)-2-phenyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazole (CAS 1015248-96-0) is a chemical compound with the molecular formula C16H14N2S and a molecular weight of 266.4 g/mol. IUPAC name: (2S)-2-phenyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazole. InChIKey: ZMYZJAQMQBHNLH-ZDUSSCGKSA-N.
| Molecular formula | C16H14N2S |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | (2S)-2-phenyl-3,4-dihydro-2H-pyrimido[2,1-b][1,3]benzothiazole |
| InChIKey | ZMYZJAQMQBHNLH-ZDUSSCGKSA-N |
| SMILES | C1CN2C3=CC=CC=C3SC2=N[C@@H]1C4=CC=CC=C4 |
Computed by PubChem (NCBI)