CAS 68729-05-5 appears in our catalog under these names: ARM1, 4-(4-Benzylphenyl)-1,3-thiazol-2-amine, 95%, ARM1, 97%, ARM1/ 99.28% (existing batch purity), ARM1 98%. Offered by: GLPBio, Combi-blocks, AmBeed, TargetMol, Chemat. Available pack sizes: 5mg, 5g, 10g, 250mg, 1g, 1mg, 10mg, 25mg.
4-(4-benzylphenyl)-1,3-thiazol-2-amine (CAS 68729-05-5) is a chemical compound with the molecular formula C16H14N2S and a molecular weight of 266.4 g/mol. IUPAC name: 4-(4-benzylphenyl)-1,3-thiazol-2-amine. InChIKey: XYDVHKCVOMGRSY-UHFFFAOYSA-N.
| Molecular formula | C16H14N2S |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 4-(4-benzylphenyl)-1,3-thiazol-2-amine |
| InChIKey | XYDVHKCVOMGRSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)