CAS 93020-52-1 appears in our catalog under these names: 4-Benzyl-5-phenyl-1,3-thiazol-2-amine, 95%, 4-Benzyl-5-phenyl-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
4-benzyl-5-phenyl-1,3-thiazol-2-amine (CAS 93020-52-1) is a chemical compound with the molecular formula C16H14N2S and a molecular weight of 266.4 g/mol. IUPAC name: 4-benzyl-5-phenyl-1,3-thiazol-2-amine. InChIKey: ICFAOMSCRJEMSN-UHFFFAOYSA-N.
| Molecular formula | C16H14N2S |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 4-benzyl-5-phenyl-1,3-thiazol-2-amine |
| InChIKey | ICFAOMSCRJEMSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(SC(=N2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)