CAS 1239015-83-8 appears in our catalog under these names: (S)–2–Benzyl–2,3–dihydrobenzo(d)imidazo(2,1–b)thiazole, (S)-2-Benzyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole, 97% 99%ee, 97% 99%ee, (S)-2-Benzyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole, 98%, (S)-2-Benzyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole, 97% 99%ee. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
(2S)-2-benzyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole (CAS 1239015-83-8) is a chemical compound with the molecular formula C16H14N2S and a molecular weight of 266.4 g/mol. IUPAC name: (2S)-2-benzyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole. InChIKey: QYOVGGRICFJFEJ-ZDUSSCGKSA-N.
| Molecular formula | C16H14N2S |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | (2S)-2-benzyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole |
| InChIKey | QYOVGGRICFJFEJ-ZDUSSCGKSA-N |
| SMILES | C1[C@@H](N=C2N1C3=CC=CC=C3S2)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)