CAS 425399-53-7 is the registry number for 2-(Diphenylmethyl)-1,3-thiazol-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-benzhydryl-1,3-thiazol-4-amine (CAS 425399-53-7) is a chemical compound with the molecular formula C16H14N2S and a molecular weight of 266.4 g/mol. IUPAC name: 2-benzhydryl-1,3-thiazol-4-amine. InChIKey: DUUZMBXMNDQVIX-UHFFFAOYSA-N.
| Molecular formula | C16H14N2S |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 2-benzhydryl-1,3-thiazol-4-amine |
| InChIKey | DUUZMBXMNDQVIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)C3=NC(=CS3)N |
Computed by PubChem (NCBI)