Products 101580-96-5
CAS 101580-96-5 appears in our catalog under these names: 2–Chloro–4–methyl–5–nitrobenzoic acid, 2-Chloro-4-methyl-5-nitrobenzoic acid, 2-Chloro-4-methyl-5-nitrobenzoic acid 97%, 2-Chloro-4-methyl-5-nitrobenzoic Acid, 97%, 97%, 2-Chloro-4-methyl-5-nitrobenzoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 25g, 1g, 5g, 10g, 100mg.
2-chloro-4-methyl-5-nitrobenzoic acid (CAS 101580-96-5) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 2-chloro-4-methyl-5-nitrobenzoic acid. InChIKey: QVOBSRFDFRRCNC-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 2-chloro-4-methyl-5-nitrobenzoic acid |
| InChIKey | QVOBSRFDFRRCNC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Cl |
Computed by PubChem (NCBI)