CAS 1015938-65-4 is the registry number for 8-Bromo-6-(trifluoromethyl)-3,4-dihydro-2H-benzo[b][1,4]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine (CAS 1015938-65-4) is a chemical compound with the molecular formula C9H7BrF3NO and a molecular weight of 282.06 g/mol. IUPAC name: 8-bromo-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: WIJKOGXQEUEODL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO |
|---|---|
| Molecular weight | 282.06 g/mol |
| IUPAC name | 8-bromo-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | WIJKOGXQEUEODL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=C(C=C2Br)C(F)(F)F |
Computed by PubChem (NCBI)