CAS 29124-62-7 is the registry number for N-Acetyl 4-bromo-2-trifluoromethylaniline, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
N-[4-bromo-2-(trifluoromethyl)phenyl]acetamide (CAS 29124-62-7) is a chemical compound with the molecular formula C9H7BrF3NO and a molecular weight of 282.06 g/mol. IUPAC name: N-[4-bromo-2-(trifluoromethyl)phenyl]acetamide. InChIKey: NJOVPNJSJCCCEC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO |
|---|---|
| Molecular weight | 282.06 g/mol |
| IUPAC name | N-[4-bromo-2-(trifluoromethyl)phenyl]acetamide |
| InChIKey | NJOVPNJSJCCCEC-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)