CAS 338451-90-4 is the registry number for N-(5-Bromo-2-methylphenyl)-2,2,2-trifluoroacetamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(5-bromo-2-methylphenyl)-2,2,2-trifluoroacetamide (CAS 338451-90-4) is a chemical compound with the molecular formula C9H7BrF3NO and a molecular weight of 282.06 g/mol. IUPAC name: N-(5-bromo-2-methylphenyl)-2,2,2-trifluoroacetamide. InChIKey: HLDVCAFZYRFQQW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO |
|---|---|
| Molecular weight | 282.06 g/mol |
| IUPAC name | N-(5-bromo-2-methylphenyl)-2,2,2-trifluoroacetamide |
| InChIKey | HLDVCAFZYRFQQW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)