CAS 1016823-37-2 is the registry number for 2-Bromo-N-(2,2,2-trifluoroethyl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-(2,2,2-trifluoroethyl)benzamide (CAS 1016823-37-2) is a chemical compound with the molecular formula C9H7BrF3NO and a molecular weight of 282.06 g/mol. IUPAC name: 2-bromo-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: VWWJJCILJYFKON-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO |
|---|---|
| Molecular weight | 282.06 g/mol |
| IUPAC name | 2-bromo-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | VWWJJCILJYFKON-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCC(F)(F)F)Br |
Computed by PubChem (NCBI)