Products 897579-95-2
CAS 897579-95-2 is the registry number for N-(4-Bromophenyl)-3,3,3-trifluoropropanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-bromophenyl)-3,3,3-trifluoropropanamide (CAS 897579-95-2) is a chemical compound with the molecular formula C9H7BrF3NO and a molecular weight of 282.06 g/mol. IUPAC name: N-(4-bromophenyl)-3,3,3-trifluoropropanamide. InChIKey: YUWJWTWBYXCQGW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF3NO |
|---|---|
| Molecular weight | 282.06 g/mol |
| IUPAC name | N-(4-bromophenyl)-3,3,3-trifluoropropanamide |
| InChIKey | YUWJWTWBYXCQGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CC(F)(F)F)Br |
Computed by PubChem (NCBI)