CAS 1016-45-1 appears in our catalog under these names: 5–chloro DMT (hydrochloride), 5-Chloro DMT (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 1 mg.
2-(5-chloro-1H-indol-3-yl)-N,N-dimethylethanamine;hydrochloride (CAS 1016-45-1) is a chemical compound with the molecular formula C12H16Cl2N2 and a molecular weight of 259.17 g/mol. IUPAC name: 2-(5-chloro-1H-indol-3-yl)-N,N-dimethylethanamine;hydrochloride. InChIKey: WRVJYIJSCHQCOW-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2 |
|---|---|
| Molecular weight | 259.17 g/mol |
| IUPAC name | 2-(5-chloro-1H-indol-3-yl)-N,N-dimethylethanamine;hydrochloride |
| InChIKey | WRVJYIJSCHQCOW-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=CNC2=C1C=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)