CAS 854863-55-1 is the registry number for 2-(4-Chlorophenyl)-4-dimethylaminobutyronitrile Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
2-(4-chlorophenyl)-4-(dimethylamino)butanenitrile;hydrochloride (CAS 854863-55-1) is a chemical compound with the molecular formula C12H16Cl2N2 and a molecular weight of 259.17 g/mol. IUPAC name: 2-(4-chlorophenyl)-4-(dimethylamino)butanenitrile;hydrochloride. InChIKey: FIJYIAWMHYQFFU-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2 |
|---|---|
| Molecular weight | 259.17 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4-(dimethylamino)butanenitrile;hydrochloride |
| InChIKey | FIJYIAWMHYQFFU-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(C#N)C1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)