Products 101628-74-4
CAS 101628-74-4 appears in our catalog under these names: (4R,5R)–tetrahydro–2H–pyran–2,4,5–triyl triacetate, 1,3,4-Tri-O-acetyl-2-deoxy-D-xylopyranose. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 500mg, 2g, 5g.
[(4R,5R)-2,5-diacetyloxyoxan-4-yl] acetate (CAS 101628-74-4) is a chemical compound with the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. IUPAC name: [(4R,5R)-2,5-diacetyloxyoxan-4-yl] acetate. InChIKey: DJXJTSGHFMVUCG-DIOIDXFWSA-N.
| Molecular formula | C11H16O7 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | [(4R,5R)-2,5-diacetyloxyoxan-4-yl] acetate |
| InChIKey | DJXJTSGHFMVUCG-DIOIDXFWSA-N |
| SMILES | CC(=O)O[C@@H]1CC(OC[C@H]1OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)