CAS 415704-39-1 is the registry number for Ribavirin Impurity R. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,4R,5S)-4,5-diacetyloxyoxolan-2-yl]methyl acetate (CAS 415704-39-1) is a chemical compound with the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. IUPAC name: [(2S,4R,5S)-4,5-diacetyloxyoxolan-2-yl]methyl acetate. InChIKey: MJDHNUNTWAOQPO-HBNTYKKESA-N.
| Molecular formula | C11H16O7 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | [(2S,4R,5S)-4,5-diacetyloxyoxolan-2-yl]methyl acetate |
| InChIKey | MJDHNUNTWAOQPO-HBNTYKKESA-N |
| SMILES | CC(=O)OC[C@@H]1C[C@H]([C@@H](O1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)