CAS 37076-71-4 appears in our catalog under these names: (3R,4R,5R)-5-Methyltetrahydrofuran-2,3,4-triyl triacetate, 95+%, 1,2,3-Tri-O-acetyl-5-deoxy-D-ribofuranoside. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2g, 1g, 10g.
[(2R,3R,4R)-4,5-diacetyloxy-2-methyloxolan-3-yl] acetate (CAS 37076-71-4) is a chemical compound with the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. IUPAC name: [(2R,3R,4R)-4,5-diacetyloxy-2-methyloxolan-3-yl] acetate. InChIKey: NXEJETQVUQAKTO-ZBCCYFLUSA-N.
| Molecular formula | C11H16O7 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | [(2R,3R,4R)-4,5-diacetyloxy-2-methyloxolan-3-yl] acetate |
| InChIKey | NXEJETQVUQAKTO-ZBCCYFLUSA-N |
| SMILES | C[C@@H]1[C@H]([C@H](C(O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)