Products 1234990-04-5
CAS 1234990-04-5 appears in our catalog under these names: 1,2,3-Triacetyl-5-deoxy-d-ribose, 95%, 1,2,3-Tri-O-Acetyl-5-deoxy-D-ribose. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 1g, 10g.
(4S,5R)-4-acetyl-4,5-dihydroxy-5-[(1R)-1-hydroxyethyl]heptane-2,3,6-trione (CAS 1234990-04-5) is a chemical compound with the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. IUPAC name: (4S,5R)-4-acetyl-4,5-dihydroxy-5-[(1R)-1-hydroxyethyl]heptane-2,3,6-trione. InChIKey: JTPRLNHAKSDJJX-DADVEIPYSA-N.
| Molecular formula | C11H16O7 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | (4S,5R)-4-acetyl-4,5-dihydroxy-5-[(1R)-1-hydroxyethyl]heptane-2,3,6-trione |
| InChIKey | JTPRLNHAKSDJJX-DADVEIPYSA-N |
| SMILES | C[C@H]([C@](C(=O)C)([C@](C(=O)C)(C(=O)C(=O)C)O)O)O |
Computed by PubChem (NCBI)