Products 95585-77-6
CAS 95585-77-6 is the registry number for 1,3,4-Tri-O-acetyl-2-deoxy-D-ribopyranose. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 25g, 10g.
[(4S,5R)-2,5-diacetyloxyoxan-4-yl] acetate (CAS 95585-77-6) is a chemical compound with the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. IUPAC name: [(4S,5R)-2,5-diacetyloxyoxan-4-yl] acetate. InChIKey: DJXJTSGHFMVUCG-MTULOOOASA-N.
| Molecular formula | C11H16O7 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | [(4S,5R)-2,5-diacetyloxyoxan-4-yl] acetate |
| InChIKey | DJXJTSGHFMVUCG-MTULOOOASA-N |
| SMILES | CC(=O)O[C@H]1CC(OC[C@H]1OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)