CAS 1016507-70-2 appears in our catalog under these names: 2-(3-(1-Aminoethyl)phenyl)isothiazolidine 1,1-dioxide, 95%, 3-​(1,​1-​Dioxido-​2-​isothiazolidinyl)​-​α-​methyl-benzenemethanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]ethanamine (CAS 1016507-70-2) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]ethanamine. InChIKey: VOLCEGNUCYAADY-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 1-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]ethanamine |
| InChIKey | VOLCEGNUCYAADY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)N2CCCS2(=O)=O)N |
Computed by PubChem (NCBI)