Products 1016514-24-1
CAS 1016514-24-1 appears in our catalog under these names: 1-[(3-Aminophenyl)methyl]-1,2,3,6-tetrahydropyridazine-3,6-dione, 95%, 1-((3-Aminophenyl)methyl)-1,2,3,6-tetrahydropyridazine-3,6-dione, 98%, 1-((3-Aminophenyl)methyl)-1,2,3,6-tetrahydropyridazine-3,6-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-[(3-aminophenyl)methyl]-1H-pyridazine-3,6-dione (CAS 1016514-24-1) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 2-[(3-aminophenyl)methyl]-1H-pyridazine-3,6-dione. InChIKey: GYPNMLSKNDYTPV-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-[(3-aminophenyl)methyl]-1H-pyridazine-3,6-dione |
| InChIKey | GYPNMLSKNDYTPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CN2C(=O)C=CC(=O)N2 |
Computed by PubChem (NCBI)