CAS 42212-19-1 is the registry number for 6-Amino-3-methyl-1-phenyl-1h-pyrimidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-amino-3-methyl-1-phenylpyrimidine-2,4-dione (CAS 42212-19-1) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 6-amino-3-methyl-1-phenylpyrimidine-2,4-dione. InChIKey: QZMWMPFVPMZGTH-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 6-amino-3-methyl-1-phenylpyrimidine-2,4-dione |
| InChIKey | QZMWMPFVPMZGTH-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=C(N(C1=O)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)