CAS 1052558-30-1 appears in our catalog under these names: 6-(3,5-Dimethyl-1h-pyrazol-1-yl)nicotinic acid, 95%, 6-(3,5-Dimethyl-1H-pyrazol-1-yl)pyridine-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid (CAS 1052558-30-1) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid. InChIKey: OYDQYWLLZLOLAJ-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid |
| InChIKey | OYDQYWLLZLOLAJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=NC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)