Products 887350-84-7
CAS 887350-84-7 appears in our catalog under these names: Methyl 1-cyclopropylbenzotriazole-5-carboxylate, 98%, Methyl 1-cyclopropyl-1H-benzo[d][1,2,3]triazole-5-carboxylate, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g.
Methyl 1-cyclopropylbenzotriazole-5-carboxylate (CAS 887350-84-7) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: methyl 1-cyclopropylbenzotriazole-5-carboxylate. InChIKey: UIFVVSTTZRWKFU-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | methyl 1-cyclopropylbenzotriazole-5-carboxylate |
| InChIKey | UIFVVSTTZRWKFU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N(N=N2)C3CC3 |
Computed by PubChem (NCBI)