Products 858003-28-8
CAS 858003-28-8 appears in our catalog under these names: 4-(3,5-Dimethyl-1h-1,2,4-triazol-1-yl)benzoic acid, 95%, 4–(3，5–Dimethyl–1H–1，2，4–triazol–1–yl)benzoic acid, 4-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)benzoic acid, 4-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)benzoic acid 95%, 4-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 25g, 10g, 1g, 100mg, 2,5g.
4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoic acid (CAS 858003-28-8) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoic acid. InChIKey: SAZZTADGKDAIAE-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 4-(3,5-dimethyl-1,2,4-triazol-1-yl)benzoic acid |
| InChIKey | SAZZTADGKDAIAE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)