Products 1016514-45-6

CAS 1016514-45-6 is the registry number for 2-({(4-(Trifluoromethoxy)phenyl)methyl}sulfanyl)acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]acetic acid (CAS 1016514-45-6) is a chemical compound with the molecular formula C10H9F3O3S and a molecular weight of 266.24 g/mol. IUPAC name: 2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]acetic acid. InChIKey: IZUKBDRGSSLVQT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9F3O3S
Molecular weight266.24 g/mol
IUPAC name2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]acetic acid
InChIKeyIZUKBDRGSSLVQT-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CSCC(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)