CAS 1354960-85-2 appears in our catalog under these names: 1-(4-(2,2,2-Trifluoroethanesulfonyl)phenyl)ethan-1-one, 95%, 1-(4-(2,2,2-Trifluoroethanesulfonyl)phenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]ethanone (CAS 1354960-85-2) is a chemical compound with the molecular formula C10H9F3O3S and a molecular weight of 266.24 g/mol. IUPAC name: 1-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]ethanone. InChIKey: SREAQPREDDJRKY-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3S |
|---|---|
| Molecular weight | 266.24 g/mol |
| IUPAC name | 1-[4-(2,2,2-trifluoroethylsulfonyl)phenyl]ethanone |
| InChIKey | SREAQPREDDJRKY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)CC(F)(F)F |
Computed by PubChem (NCBI)