Products 901418-29-9
CAS 901418-29-9 is the registry number for 2-({(3-(Trifluoromethoxy)phenyl)methyl}sulfanyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-[[3-(trifluoromethoxy)phenyl]methylsulfanyl]acetic acid (CAS 901418-29-9) is a chemical compound with the molecular formula C10H9F3O3S and a molecular weight of 266.24 g/mol. IUPAC name: 2-[[3-(trifluoromethoxy)phenyl]methylsulfanyl]acetic acid. InChIKey: UKCGLSVQHFVXEV-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3S |
|---|---|
| Molecular weight | 266.24 g/mol |
| IUPAC name | 2-[[3-(trifluoromethoxy)phenyl]methylsulfanyl]acetic acid |
| InChIKey | UKCGLSVQHFVXEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)CSCC(=O)O |
Computed by PubChem (NCBI)