CAS 109586-43-8 appears in our catalog under these names: 2-Allylphenyl trifluoromethanesulfonate, 98%, 1,1,1-Trifluoromethanesulfonic Acid 2-(2-Propen-1-yl)phenyl Ester. Offered by: AmBeed, TRC, Fluorochem. Available pack sizes: 5g, 250mg, 25mg, 100mg, 1g.
(2-prop-2-enylphenyl) trifluoromethanesulfonate (CAS 109586-43-8) is a chemical compound with the molecular formula C10H9F3O3S and a molecular weight of 266.24 g/mol. IUPAC name: (2-prop-2-enylphenyl) trifluoromethanesulfonate. InChIKey: GOJIIZZUXJZZNC-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3S |
|---|---|
| Molecular weight | 266.24 g/mol |
| IUPAC name | (2-prop-2-enylphenyl) trifluoromethanesulfonate |
| InChIKey | GOJIIZZUXJZZNC-UHFFFAOYSA-N |
| SMILES | C=CCC1=CC=CC=C1OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)