Products 1016522-59-0
CAS 1016522-59-0 appears in our catalog under these names: 3-((2-Methoxyethyl)carbamoyl)benzene-1-sulfonyl chloride, 95%, 3-((2-Methoxyethyl)carbamoyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(2-methoxyethylcarbamoyl)benzenesulfonyl chloride (CAS 1016522-59-0) is a chemical compound with the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. IUPAC name: 3-(2-methoxyethylcarbamoyl)benzenesulfonyl chloride. InChIKey: AJTHTMQVVZOTJZ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO4S |
|---|---|
| Molecular weight | 277.73 g/mol |
| IUPAC name | 3-(2-methoxyethylcarbamoyl)benzenesulfonyl chloride |
| InChIKey | AJTHTMQVVZOTJZ-UHFFFAOYSA-N |
| SMILES | COCCNC(=O)C1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)