Products 1114594-37-4

CAS 1114594-37-4 appears in our catalog under these names: 3-[(Ethylamino)carbonyl]-4-methoxybenzenesulfonyl chloride, 95%, 3-(Ethylcarbamoyl)-4-methoxybenzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(ethylcarbamoyl)-4-methoxybenzenesulfonyl chloride (CAS 1114594-37-4) is a chemical compound with the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. IUPAC name: 3-(ethylcarbamoyl)-4-methoxybenzenesulfonyl chloride. InChIKey: PZDOXCGWMVGULO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO4S
Molecular weight277.73 g/mol
IUPAC name3-(ethylcarbamoyl)-4-methoxybenzenesulfonyl chloride
InChIKeyPZDOXCGWMVGULO-UHFFFAOYSA-N
SMILESCCNC(=O)C1=C(C=CC(=C1)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)