Products 1114594-34-1

CAS 1114594-34-1 appears in our catalog under these names: 3-(Dimethylcarbamoyl)-4-methoxybenzene-1-sulfonyl chloride, 3-(Dimethylcarbamoyl)-4-methoxybenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

3-(dimethylcarbamoyl)-4-methoxybenzenesulfonyl chloride (CAS 1114594-34-1) is a chemical compound with the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. IUPAC name: 3-(dimethylcarbamoyl)-4-methoxybenzenesulfonyl chloride. InChIKey: BOHPKYZEFYAUFB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO4S
Molecular weight277.73 g/mol
IUPAC name3-(dimethylcarbamoyl)-4-methoxybenzenesulfonyl chloride
InChIKeyBOHPKYZEFYAUFB-UHFFFAOYSA-N
SMILESCN(C)C(=O)C1=C(C=CC(=C1)S(=O)(=O)Cl)OC

Computed by PubChem (NCBI)