Products 362715-18-2

CAS 362715-18-2 is the registry number for N-(5-Chloro-2-methylphenyl)-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(5-chloro-2-methyl-N-methylsulfonylanilino)acetic acid (CAS 362715-18-2) is a chemical compound with the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. IUPAC name: 2-(5-chloro-2-methyl-N-methylsulfonylanilino)acetic acid. InChIKey: KZFDQAGVVPBQRW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO4S
Molecular weight277.73 g/mol
IUPAC name2-(5-chloro-2-methyl-N-methylsulfonylanilino)acetic acid
InChIKeyKZFDQAGVVPBQRW-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)Cl)N(CC(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)