Products 300727-24-6
CAS 300727-24-6 is the registry number for Methyl 3-(4-chlorobenzenesulfonamido)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-[(4-chlorophenyl)sulfonylamino]propanoate (CAS 300727-24-6) is a chemical compound with the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. IUPAC name: methyl 3-[(4-chlorophenyl)sulfonylamino]propanoate. InChIKey: FQWFNSIPERCXIG-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO4S |
|---|---|
| Molecular weight | 277.73 g/mol |
| IUPAC name | methyl 3-[(4-chlorophenyl)sulfonylamino]propanoate |
| InChIKey | FQWFNSIPERCXIG-UHFFFAOYSA-N |
| SMILES | COC(=O)CCNS(=O)(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)