Products 1016531-70-6
CAS 1016531-70-6 is the registry number for 6-Chloro-N-(pentan-2-yl)pyridine-3-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-chloro-N-pentan-2-ylpyridine-3-sulfonamide (CAS 1016531-70-6) is a chemical compound with the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. IUPAC name: 6-chloro-N-pentan-2-ylpyridine-3-sulfonamide. InChIKey: GQKPVPIFAINCHD-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2S |
|---|---|
| Molecular weight | 262.76 g/mol |
| IUPAC name | 6-chloro-N-pentan-2-ylpyridine-3-sulfonamide |
| InChIKey | GQKPVPIFAINCHD-UHFFFAOYSA-N |
| SMILES | CCCC(C)NS(=O)(=O)C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)