Products 2137710-04-2
CAS 2137710-04-2 appears in our catalog under these names: N-[3-(aminomethyl)phenyl]cyclopropanesulfonamide hydrochloride, 95%, N-(3-(Aminomethyl)phenyl)cyclopropanesulfonamide hydrochloride, 98%, N-(3-(Aminomethyl)phenyl)cyclopropanesulfonamide hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
N-[3-(aminomethyl)phenyl]cyclopropanesulfonamide;hydrochloride (CAS 2137710-04-2) is a chemical compound with the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. IUPAC name: N-[3-(aminomethyl)phenyl]cyclopropanesulfonamide;hydrochloride. InChIKey: XCLSCTJKLRPWBE-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2S |
|---|---|
| Molecular weight | 262.76 g/mol |
| IUPAC name | N-[3-(aminomethyl)phenyl]cyclopropanesulfonamide;hydrochloride |
| InChIKey | XCLSCTJKLRPWBE-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)NC2=CC=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)