Products 1217653-08-1

CAS 1217653-08-1 is the registry number for Ethyl 2-((r)-pyrrolidin-2-yl)thiazole-4-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-pyrrolidin-2-yl-1,3-thiazole-4-carboxylate;hydrochloride (CAS 1217653-08-1) is a chemical compound with the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. IUPAC name: ethyl 2-pyrrolidin-2-yl-1,3-thiazole-4-carboxylate;hydrochloride. InChIKey: RWZYILAQTIQGAU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15ClN2O2S
Molecular weight262.76 g/mol
IUPAC nameethyl 2-pyrrolidin-2-yl-1,3-thiazole-4-carboxylate;hydrochloride
InChIKeyRWZYILAQTIQGAU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)C2CCCN2.Cl

Computed by PubChem (NCBI)