CAS 1423031-15-5 appears in our catalog under these names: 1-Methanesulfonyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine hydrochloride, 95%, 1-Methanesulfonyl-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-methylsulfonyl-2,3,4,5-tetrahydro-1,4-benzodiazepine;hydrochloride (CAS 1423031-15-5) is a chemical compound with the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. IUPAC name: 1-methylsulfonyl-2,3,4,5-tetrahydro-1,4-benzodiazepine;hydrochloride. InChIKey: GOKVONWHKFQJNH-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2S |
|---|---|
| Molecular weight | 262.76 g/mol |
| IUPAC name | 1-methylsulfonyl-2,3,4,5-tetrahydro-1,4-benzodiazepine;hydrochloride |
| InChIKey | GOKVONWHKFQJNH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCNCC2=CC=CC=C21.Cl |
Computed by PubChem (NCBI)