CAS 1172345-00-4 appears in our catalog under these names: 2-(2,3-Dihydro-1H-indole-1-sulfonyl)ethan-1-amine hydrochloride, 95%, 2-(2,3-Dihydro-1H-indole-1-sulfonyl)ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(2,3-dihydroindol-1-ylsulfonyl)ethanamine;hydrochloride (CAS 1172345-00-4) is a chemical compound with the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. IUPAC name: 2-(2,3-dihydroindol-1-ylsulfonyl)ethanamine;hydrochloride. InChIKey: HWLYVTCCJWLSMZ-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2S |
|---|---|
| Molecular weight | 262.76 g/mol |
| IUPAC name | 2-(2,3-dihydroindol-1-ylsulfonyl)ethanamine;hydrochloride |
| InChIKey | HWLYVTCCJWLSMZ-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)S(=O)(=O)CCN.Cl |
Computed by PubChem (NCBI)