Products 1016676-77-9
CAS 1016676-77-9 is the registry number for 3-{((3-Methylphenyl)carbamoyl)methoxy}benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-[2-(3-methylanilino)-2-oxoethoxy]benzoic acid (CAS 1016676-77-9) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 3-[2-(3-methylanilino)-2-oxoethoxy]benzoic acid. InChIKey: KLTZIJUWUCLRMN-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 3-[2-(3-methylanilino)-2-oxoethoxy]benzoic acid |
| InChIKey | KLTZIJUWUCLRMN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)COC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)