CAS 1016702-87-6 is the registry number for N-Methyl-N-(4-methylthiazole-5-carbonyl)glycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[methyl-(4-methyl-1,3-thiazole-5-carbonyl)amino]acetic acid (CAS 1016702-87-6) is a chemical compound with the molecular formula C8H10N2O3S and a molecular weight of 214.24 g/mol. IUPAC name: 2-[methyl-(4-methyl-1,3-thiazole-5-carbonyl)amino]acetic acid. InChIKey: FLWWLVQIBXRVGV-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 2-[methyl-(4-methyl-1,3-thiazole-5-carbonyl)amino]acetic acid |
| InChIKey | FLWWLVQIBXRVGV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C(=O)N(C)CC(=O)O |
Computed by PubChem (NCBI)