CAS 1016723-17-3 appears in our catalog under these names: 1-(4-[(2-Chloroprop-2-en-1-yl)oxy]phenyl)ethan-1-one, 95%, 1-(4-((2-Chloroallyl)oxy)phenyl)ethan-1-one 95%, 1-(4-[(2-CHLOROPROP-2-EN-1-YL)OXY]PHENYL)ETHAN-1-ONE, 95%, 95%, 1-{4-[(2-chloroprop-2-en-1-yl)oxy]phenyl}ethan-1-one, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
1-[4-(2-chloroprop-2-enoxy)phenyl]ethanone (CAS 1016723-17-3) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: 1-[4-(2-chloroprop-2-enoxy)phenyl]ethanone. InChIKey: NMELEHAOVKUUIN-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | 1-[4-(2-chloroprop-2-enoxy)phenyl]ethanone |
| InChIKey | NMELEHAOVKUUIN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OCC(=C)Cl |
Computed by PubChem (NCBI)