CAS 943118-88-5 is the registry number for Methyl 1-(2-chlorophenyl)cyclopropanecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Methyl 1-(2-chlorophenyl)cyclopropane-1-carboxylate (CAS 943118-88-5) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: methyl 1-(2-chlorophenyl)cyclopropane-1-carboxylate. InChIKey: SNTYXFDCYIKTGB-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | methyl 1-(2-chlorophenyl)cyclopropane-1-carboxylate |
| InChIKey | SNTYXFDCYIKTGB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)